C16H14N2O — CID 163316308
4-benzyl-5-(5-methyl-2-pyridinyl)-1,3-oxazole (PubChem CID 163316308) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is 4-benzyl-5-(5-methyl-2-pyridinyl)-1,3-oxazole.
| Compound Name | 4-benzyl-5-(5-methyl-2-pyridinyl)-1,3-oxazole |
|---|---|
| PubChem CID | 163316308 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 4-benzyl-5-(5-methyl-2-pyridinyl)-1,3-oxazole |
| SMILES | Cc1ccc(-c2ocnc2Cc2ccccc2)nc1 |
| InChI | InChI=1S/C16H14N2O/c1-12-7-8-14(17-10-12)16-15(18-11-19-16)9-13-5-3-2-4-6-13/h2-8,10-11H,9H2,1H3 |
| InChIKey | OWQIMHRGBQNJIV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |