C14H15NO3 — CID 170414122
benzyl 5-propan-2-yl-1,3-oxazole-4-carboxylate (PubChem CID 170414122) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is benzyl 5-propan-2-yl-1,3-oxazole-4-carboxylate.
| Compound Name | benzyl 5-propan-2-yl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 170414122 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | benzyl 5-propan-2-yl-1,3-oxazole-4-carboxylate |
| SMILES | CC(C)c1ocnc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H15NO3/c1-10(2)13-12(15-9-18-13)14(16)17-8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | UBIUMHIDUVJBPL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |