About [(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl 5-propan-2-yl-1,3-oxazole-4-carboxylate
[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl 5-propan-2-yl-1,3-oxazole-4-carboxylate (PubChem CID 97215614) has the molecular formula C16H16FNO4
and a molecular weight of 305.31 g/mol. Its IUPAC name is [(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl 5-propan-2-yl-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | [(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl 5-propan-2-yl-1,3-oxazole-4-carboxylate |
| PubChem CID | 97215614 |
| Molecular Formula | C16H16FNO4 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | [(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl 5-propan-2-yl-1,3-oxazole-4-carboxylate |
| SMILES | CC(C)c1ocnc1C(=O)OC[C@@H]1Cc2cc(F)ccc2O1 |
| InChI | InChI=1S/C16H16FNO4/c1-9(2)15-14(18-8-21-15)16(19)20-7-12-6-10-5-11(17)3-4-13(10)22-12/h3-5,8-9,12H,6-7H2,1-2H3/t12-/m0/s1 |
| InChIKey | IRMDEYAWYYPHDH-LBPRGKRZSA-N |
| XLogP | 3.10 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl 5-propan-2-yl-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl 5-propan-2-yl-1,3-oxazole-4-carboxylate?
The IUPAC name of [(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl 5-propan-2-yl-1,3-oxazole-4-carboxylate (CID 97215614) is [(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl 5-propan-2-yl-1,3-oxazole-4-carboxylate.
What is the SMILES notation for [(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl 5-propan-2-yl-1,3-oxazole-4-carboxylate?
The canonical SMILES for [(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl 5-propan-2-yl-1,3-oxazole-4-carboxylate is CC(C)c1ocnc1C(=O)OC[C@@H]1Cc2cc(F)ccc2O1.
What is the InChIKey of [(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl 5-propan-2-yl-1,3-oxazole-4-carboxylate?
The InChIKey is IRMDEYAWYYPHDH-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H16FNO4/c1-9(2)15-14(18-8-21-15)16(19)20-7-12-6-10-5-11(17)3-4-13(10)22-12/h3-5,8-9,12H,6-7H2,1-2H3/t12-/m0/s1.
What are the key properties of [(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl 5-propan-2-yl-1,3-oxazole-4-carboxylate?
[(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl 5-propan-2-yl-1,3-oxazole-4-carboxylate has a molecular weight of 305.31 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl 5-propan-2-yl-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 97215614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).