C15H16N2O5 — CID 71848845
2-(2-nitrophenyl)ethyl 5-propan-2-yl-1,3-oxazole-4-carboxylate (PubChem CID 71848845) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is 2-(2-nitrophenyl)ethyl 5-propan-2-yl-1,3-oxazole-4-carboxylate.
| Compound Name | 2-(2-nitrophenyl)ethyl 5-propan-2-yl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 71848845 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-(2-nitrophenyl)ethyl 5-propan-2-yl-1,3-oxazole-4-carboxylate |
| SMILES | CC(C)c1ocnc1C(=O)OCCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16N2O5/c1-10(2)14-13(16-9-22-14)15(18)21-8-7-11-5-3-4-6-12(11)17(19)20/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | NJIKDNOCDRQINN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|