C17H14N4O4 — CID 71917043
2-(2-nitrophenyl)ethyl 3-(1,2,4-triazol-1-yl)benzoate (PubChem CID 71917043) has the molecular formula C17H14N4O4 and a molecular weight of 338.32 g/mol. Its IUPAC name is 2-(2-nitrophenyl)ethyl 3-(1,2,4-triazol-1-yl)benzoate.
| Compound Name | 2-(2-nitrophenyl)ethyl 3-(1,2,4-triazol-1-yl)benzoate |
|---|---|
| PubChem CID | 71917043 |
| Molecular Formula | C17H14N4O4 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 2-(2-nitrophenyl)ethyl 3-(1,2,4-triazol-1-yl)benzoate |
| SMILES | O=C(OCCc1ccccc1[N+](=O)[O-])c1cccc(-n2cncn2)c1 |
| InChI | InChI=1S/C17H14N4O4/c22-17(14-5-3-6-15(10-14)20-12-18-11-19-20)25-9-8-13-4-1-2-7-16(13)21(23)24/h1-7,10-12H,8-9H2 |
| InChIKey | BZTVKZRVMFLKCP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|