About piperazin-1-yl-(5-propyl-1,3-oxazol-4-yl)methanone
piperazin-1-yl-(5-propyl-1,3-oxazol-4-yl)methanone (PubChem CID 82509550) has the molecular formula C11H17N3O2
and a molecular weight of 223.28 g/mol. Its IUPAC name is piperazin-1-yl-(5-propyl-1,3-oxazol-4-yl)methanone.
Molecular Properties
| Compound Name | piperazin-1-yl-(5-propyl-1,3-oxazol-4-yl)methanone |
| PubChem CID | 82509550 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | piperazin-1-yl-(5-propyl-1,3-oxazol-4-yl)methanone |
| SMILES | CCCc1ocnc1C(=O)N1CCNCC1 |
| InChI | InChI=1S/C11H17N3O2/c1-2-3-9-10(13-8-16-9)11(15)14-6-4-12-5-7-14/h8,12H,2-7H2,1H3 |
| InChIKey | ZWEDOPSDNBLEQX-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperazin-1-yl-(5-propyl-1,3-oxazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazin-1-yl-(5-propyl-1,3-oxazol-4-yl)methanone?
The IUPAC name of piperazin-1-yl-(5-propyl-1,3-oxazol-4-yl)methanone (CID 82509550) is piperazin-1-yl-(5-propyl-1,3-oxazol-4-yl)methanone.
What is the SMILES notation for piperazin-1-yl-(5-propyl-1,3-oxazol-4-yl)methanone?
The canonical SMILES for piperazin-1-yl-(5-propyl-1,3-oxazol-4-yl)methanone is CCCc1ocnc1C(=O)N1CCNCC1.
What is the InChIKey of piperazin-1-yl-(5-propyl-1,3-oxazol-4-yl)methanone?
The InChIKey is ZWEDOPSDNBLEQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O2/c1-2-3-9-10(13-8-16-9)11(15)14-6-4-12-5-7-14/h8,12H,2-7H2,1H3.
What are the key properties of piperazin-1-yl-(5-propyl-1,3-oxazol-4-yl)methanone?
piperazin-1-yl-(5-propyl-1,3-oxazol-4-yl)methanone has a molecular weight of 223.28 g/mol, XLogP of 0.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazin-1-yl-(5-propyl-1,3-oxazol-4-yl)methanone is sourced from PubChem (CID 82509550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).