C8H12N4OS — CID 117214816
(5-amino-1,3-thiazol-4-yl)-piperazin-1-ylmethanone (PubChem CID 117214816) has the molecular formula C8H12N4OS and a molecular weight of 212.28 g/mol. Its IUPAC name is (5-amino-1,3-thiazol-4-yl)-piperazin-1-ylmethanone.
| Compound Name | (5-amino-1,3-thiazol-4-yl)-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 117214816 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | (5-amino-1,3-thiazol-4-yl)-piperazin-1-ylmethanone |
| SMILES | Nc1scnc1C(=O)N1CCNCC1 |
| InChI | InChI=1S/C8H12N4OS/c9-7-6(11-5-14-7)8(13)12-3-1-10-2-4-12/h5,10H,1-4,9H2 |
| InChIKey | AGKRZIXSVOPJPT-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |