C7H10N4OS — CID 43522513
piperazin-1-yl(1,2,5-thiadiazol-3-yl)methanone (PubChem CID 43522513) has the molecular formula C7H10N4OS and a molecular weight of 198.25 g/mol. Its IUPAC name is piperazin-1-yl(1,2,5-thiadiazol-3-yl)methanone.
| Compound Name | piperazin-1-yl(1,2,5-thiadiazol-3-yl)methanone |
|---|---|
| PubChem CID | 43522513 |
| Molecular Formula | C7H10N4OS |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | piperazin-1-yl(1,2,5-thiadiazol-3-yl)methanone |
| SMILES | O=C(c1cnsn1)N1CCNCC1 |
| InChI | InChI=1S/C7H10N4OS/c12-7(6-5-9-13-10-6)11-3-1-8-2-4-11/h5,8H,1-4H2 |
| InChIKey | MBNSTEPFUSCKPC-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |