C8H10N4O2S — CID 62046931
1-(1,2,5-thiadiazole-3-carbonyl)-1,4-diazepan-5-one (PubChem CID 62046931) has the molecular formula C8H10N4O2S and a molecular weight of 226.26 g/mol. Its IUPAC name is 1-(1,2,5-thiadiazole-3-carbonyl)-1,4-diazepan-5-one.
| Compound Name | 1-(1,2,5-thiadiazole-3-carbonyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 62046931 |
| Molecular Formula | C8H10N4O2S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 1-(1,2,5-thiadiazole-3-carbonyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)c2cnsn2)CCN1 |
| InChI | InChI=1S/C8H10N4O2S/c13-7-1-3-12(4-2-9-7)8(14)6-5-10-15-11-6/h5H,1-4H2,(H,9,13) |
| InChIKey | KNSXDAJVGSDXCF-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |