C11H16N4O2S — CID 136516092
1-[2-(ethylamino)-1,3-thiazole-4-carbonyl]-1,4-diazepan-5-one (PubChem CID 136516092) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is 1-[2-(ethylamino)-1,3-thiazole-4-carbonyl]-1,4-diazepan-5-one.
| Compound Name | 1-[2-(ethylamino)-1,3-thiazole-4-carbonyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 136516092 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-[2-(ethylamino)-1,3-thiazole-4-carbonyl]-1,4-diazepan-5-one |
| SMILES | CCNc1nc(C(=O)N2CCNC(=O)CC2)cs1 |
| InChI | InChI=1S/C11H16N4O2S/c1-2-12-11-14-8(7-18-11)10(17)15-5-3-9(16)13-4-6-15/h7H,2-6H2,1H3,(H,12,14)(H,13,16) |
| InChIKey | OBDNRECIFQCFEQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |