About (2-aminopyrimidin-5-yl) piperazine-1-carboxylate
(2-aminopyrimidin-5-yl) piperazine-1-carboxylate (PubChem CID 130176333) has the molecular formula C9H13N5O2
and a molecular weight of 223.24 g/mol. Its IUPAC name is (2-aminopyrimidin-5-yl) piperazine-1-carboxylate.
Molecular Properties
| Compound Name | (2-aminopyrimidin-5-yl) piperazine-1-carboxylate |
| PubChem CID | 130176333 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | (2-aminopyrimidin-5-yl) piperazine-1-carboxylate |
| SMILES | Nc1ncc(OC(=O)N2CCNCC2)cn1 |
| InChI | InChI=1S/C9H13N5O2/c10-8-12-5-7(6-13-8)16-9(15)14-3-1-11-2-4-14/h5-6,11H,1-4H2,(H2,10,12,13) |
| InChIKey | WJVGQNRDAYLGJW-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-aminopyrimidin-5-yl) piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminopyrimidin-5-yl) piperazine-1-carboxylate?
The IUPAC name of (2-aminopyrimidin-5-yl) piperazine-1-carboxylate (CID 130176333) is (2-aminopyrimidin-5-yl) piperazine-1-carboxylate.
What is the SMILES notation for (2-aminopyrimidin-5-yl) piperazine-1-carboxylate?
The canonical SMILES for (2-aminopyrimidin-5-yl) piperazine-1-carboxylate is Nc1ncc(OC(=O)N2CCNCC2)cn1.
What is the InChIKey of (2-aminopyrimidin-5-yl) piperazine-1-carboxylate?
The InChIKey is WJVGQNRDAYLGJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5O2/c10-8-12-5-7(6-13-8)16-9(15)14-3-1-11-2-4-14/h5-6,11H,1-4H2,(H2,10,12,13).
What are the key properties of (2-aminopyrimidin-5-yl) piperazine-1-carboxylate?
(2-aminopyrimidin-5-yl) piperazine-1-carboxylate has a molecular weight of 223.24 g/mol, XLogP of -0.54, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminopyrimidin-5-yl) piperazine-1-carboxylate is sourced from PubChem (CID 130176333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).