About anilino piperazine-1-carboxylate
anilino piperazine-1-carboxylate (PubChem CID 87684063) has the molecular formula C11H15N3O2
and a molecular weight of 221.26 g/mol. Its IUPAC name is anilino piperazine-1-carboxylate.
Molecular Properties
| Compound Name | anilino piperazine-1-carboxylate |
| PubChem CID | 87684063 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | anilino piperazine-1-carboxylate |
| SMILES | O=C(ONc1ccccc1)N1CCNCC1 |
| InChI | InChI=1S/C11H15N3O2/c15-11(14-8-6-12-7-9-14)16-13-10-4-2-1-3-5-10/h1-5,12-13H,6-9H2 |
| InChIKey | IJKSMFLESHUFJQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze anilino piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anilino piperazine-1-carboxylate?
The IUPAC name of anilino piperazine-1-carboxylate (CID 87684063) is anilino piperazine-1-carboxylate.
What is the SMILES notation for anilino piperazine-1-carboxylate?
The canonical SMILES for anilino piperazine-1-carboxylate is O=C(ONc1ccccc1)N1CCNCC1.
What is the InChIKey of anilino piperazine-1-carboxylate?
The InChIKey is IJKSMFLESHUFJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O2/c15-11(14-8-6-12-7-9-14)16-13-10-4-2-1-3-5-10/h1-5,12-13H,6-9H2.
What are the key properties of anilino piperazine-1-carboxylate?
anilino piperazine-1-carboxylate has a molecular weight of 221.26 g/mol, XLogP of 1.06, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for anilino piperazine-1-carboxylate is sourced from PubChem (CID 87684063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).