About (2-aminobenzoyl) piperazine-1-carboxylate
(2-aminobenzoyl) piperazine-1-carboxylate (PubChem CID 174897357) has the molecular formula C12H15N3O3
and a molecular weight of 249.27 g/mol. Its IUPAC name is (2-aminobenzoyl) piperazine-1-carboxylate.
Molecular Properties
| Compound Name | (2-aminobenzoyl) piperazine-1-carboxylate |
| PubChem CID | 174897357 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | (2-aminobenzoyl) piperazine-1-carboxylate |
| SMILES | Nc1ccccc1C(=O)OC(=O)N1CCNCC1 |
| InChI | InChI=1S/C12H15N3O3/c13-10-4-2-1-3-9(10)11(16)18-12(17)15-7-5-14-6-8-15/h1-4,14H,5-8,13H2 |
| InChIKey | UWIGSMGZWLWLNO-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-aminobenzoyl) piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminobenzoyl) piperazine-1-carboxylate?
The IUPAC name of (2-aminobenzoyl) piperazine-1-carboxylate (CID 174897357) is (2-aminobenzoyl) piperazine-1-carboxylate.
What is the SMILES notation for (2-aminobenzoyl) piperazine-1-carboxylate?
The canonical SMILES for (2-aminobenzoyl) piperazine-1-carboxylate is Nc1ccccc1C(=O)OC(=O)N1CCNCC1.
What is the InChIKey of (2-aminobenzoyl) piperazine-1-carboxylate?
The InChIKey is UWIGSMGZWLWLNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O3/c13-10-4-2-1-3-9(10)11(16)18-12(17)15-7-5-14-6-8-15/h1-4,14H,5-8,13H2.
What are the key properties of (2-aminobenzoyl) piperazine-1-carboxylate?
(2-aminobenzoyl) piperazine-1-carboxylate has a molecular weight of 249.27 g/mol, XLogP of 0.45, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminobenzoyl) piperazine-1-carboxylate is sourced from PubChem (CID 174897357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).