C8H12N4O2 — CID 117218069
(3-amino-1,2-oxazol-5-yl)-piperazin-1-ylmethanone (PubChem CID 117218069) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is (3-amino-1,2-oxazol-5-yl)-piperazin-1-ylmethanone.
| Compound Name | (3-amino-1,2-oxazol-5-yl)-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 117218069 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | (3-amino-1,2-oxazol-5-yl)-piperazin-1-ylmethanone |
| SMILES | Nc1cc(C(=O)N2CCNCC2)on1 |
| InChI | InChI=1S/C8H12N4O2/c9-7-5-6(14-11-7)8(13)12-3-1-10-2-4-12/h5,10H,1-4H2,(H2,9,11) |
| InChIKey | WQFSGIMDGZRFKA-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |