C8H12N2O3 — CID 105441021
methyl 2-(3-aminopropyl)-1,3-oxazole-5-carboxylate (PubChem CID 105441021) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is methyl 2-(3-aminopropyl)-1,3-oxazole-5-carboxylate.
| Compound Name | methyl 2-(3-aminopropyl)-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 105441021 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | methyl 2-(3-aminopropyl)-1,3-oxazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(CCCN)o1 |
| InChI | InChI=1S/C8H12N2O3/c1-12-8(11)6-5-10-7(13-6)3-2-4-9/h5H,2-4,9H2,1H3 |
| InChIKey | OAHHAPUQAOFERU-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |