C10H12N2O — CID 119083202
(NE)-N-(1,2,3,4-tetrahydroisoquinolin-6-ylmethylidene)hydroxylamine (PubChem CID 119083202) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is (NE)-N-(1,2,3,4-tetrahydroisoquinolin-6-ylmethylidene)hydroxylamine.
| Compound Name | (NE)-N-(1,2,3,4-tetrahydroisoquinolin-6-ylmethylidene)hydroxylamine |
|---|---|
| PubChem CID | 119083202 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | (NE)-N-(1,2,3,4-tetrahydroisoquinolin-6-ylmethylidene)hydroxylamine |
| SMILES | O/N=C/c1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C10H12N2O/c13-12-6-8-1-2-10-7-11-4-3-9(10)5-8/h1-2,5-6,11,13H,3-4,7H2/b12-6+ |
| InChIKey | ASSPCHZAZDJRLN-WUXMJOGZSA-N |
| XLogP | 1.14 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|