C10H13N3S — CID 119083625
N-ethyl-N,5-dimethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 119083625) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is N-ethyl-N,5-dimethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-ethyl-N,5-dimethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 119083625 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | N-ethyl-N,5-dimethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCN(C)c1ncnc2scc(C)c12 |
| InChI | InChI=1S/C10H13N3S/c1-4-13(3)9-8-7(2)5-14-10(8)12-6-11-9/h5-6H,4H2,1-3H3 |
| InChIKey | HRTSJEMFEHQBDS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |