C14H24N4O2S — CID 143487927
ethane;4-N-ethyl-4-N,6-dimethylthieno[2,3-d]pyrimidine-4,5-diamine;methyl formate (PubChem CID 143487927) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is ethane;4-N-ethyl-4-N,6-dimethylthieno[2,3-d]pyrimidine-4,5-diamine;methyl formate.
| Compound Name | ethane;4-N-ethyl-4-N,6-dimethylthieno[2,3-d]pyrimidine-4,5-diamine;methyl formate |
|---|---|
| PubChem CID | 143487927 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | ethane;4-N-ethyl-4-N,6-dimethylthieno[2,3-d]pyrimidine-4,5-diamine;methyl formate |
| SMILES | CC.CCN(C)c1ncnc2sc(C)c(N)c12.COC=O |
| InChI | InChI=1S/C10H14N4S.C2H4O2.C2H6/c1-4-14(3)9-7-8(11)6(2)15-10(7)13-5-12-9;1-4-2-3;1-2/h5H,4,11H2,1-3H3;2H,1H3;1-2H3 |
| InChIKey | NZWPHDPACYQAEV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|