C11H7NOS — CID 119084991
4-(furan-2-yl)thieno[3,2-c]pyridine (PubChem CID 119084991) has the molecular formula C11H7NOS and a molecular weight of 201.25 g/mol. Its IUPAC name is 4-(furan-2-yl)thieno[3,2-c]pyridine.
| Compound Name | 4-(furan-2-yl)thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 119084991 |
| Molecular Formula | C11H7NOS |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | 4-(furan-2-yl)thieno[3,2-c]pyridine |
| SMILES | c1coc(-c2nccc3sccc23)c1 |
| InChI | InChI=1S/C11H7NOS/c1-2-9(13-6-1)11-8-4-7-14-10(8)3-5-12-11/h1-7H |
| InChIKey | WOCPXRDRTWKTJV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |