C25H17N3O2S — CID 145985805
Myc-IN-2 (PubChem CID 145985805) has the molecular formula C25H17N3O2S and a molecular weight of 423.50 g/mol. Its IUPAC name is 4-[2-(furan-2-yl)-6-[4-(1,3-thiazol-2-yl)phenyl]-4-pyridinyl]benzamide.
| Compound Name | Myc-IN-2 |
|---|---|
| PubChem CID | 145985805 |
| Molecular Formula | C25H17N3O2S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 4-[2-(furan-2-yl)-6-[4-(1,3-thiazol-2-yl)phenyl]-4-pyridinyl]benzamide |
| SMILES | C1=COC(=C1)C2=CC(=CC(=N2)C3=CC=C(C=C3)C4=NC=CS4)C5=CC=C(C=C5)C(=O)N |
| InChI | InChI=1S/C25H17N3O2S/c26-24(29)18-7-3-16(4-8-18)20-14-21(28-22(15-20)23-2-1-12-30-23)17-5-9-19(10-6-17)25-27-11-13-31-25/h1-15H,(H2,26,29) |
| InChIKey | HMVOKQDXOYWIBC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | 604 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |