C16H12FN3O2S — CID 122539741
4-(4-fluorophenyl)-5-(1,3-thiazol-5-ylmethoxy)pyridine-2-carboxamide (PubChem CID 122539741) has the molecular formula C16H12FN3O2S and a molecular weight of 329.36 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-5-(1,3-thiazol-5-ylmethoxy)pyridine-2-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-5-(1,3-thiazol-5-ylmethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 122539741 |
| Molecular Formula | C16H12FN3O2S |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 4-(4-fluorophenyl)-5-(1,3-thiazol-5-ylmethoxy)pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(F)cc2)c(OCc2cncs2)cn1 |
| InChI | InChI=1S/C16H12FN3O2S/c17-11-3-1-10(2-4-11)13-5-14(16(18)21)20-7-15(13)22-8-12-6-19-9-23-12/h1-7,9H,8H2,(H2,18,21) |
| InChIKey | NYSBMRXWWLXZJU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |