C17H13N3O3S — CID 10882328
[2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2-phenylacetate (PubChem CID 10882328) has the molecular formula C17H13N3O3S and a molecular weight of 339.38 g/mol. Its IUPAC name is [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2-phenylacetate.
| Compound Name | [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2-phenylacetate |
|---|---|
| PubChem CID | 10882328 |
| Molecular Formula | C17H13N3O3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2-phenylacetate |
| SMILES | O=C(Cc1ccccc1)Oc1cccnc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C17H13N3O3S/c21-14(11-12-5-2-1-3-6-12)23-13-7-4-8-18-15(13)16(22)20-17-19-9-10-24-17/h1-10H,11H2,(H,19,20,22) |
| InChIKey | NWWWVBHZVPTUKC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |