C17H11N3O2S — CID 2082785
2-(furan-2-yl)-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide (PubChem CID 2082785) has the molecular formula C17H11N3O2S and a molecular weight of 321.36 g/mol. Its IUPAC name is 2-(furan-2-yl)-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide.
| Compound Name | 2-(furan-2-yl)-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 2082785 |
| Molecular Formula | C17H11N3O2S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2-(furan-2-yl)-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide |
| SMILES | O=C(Nc1nccs1)c1cc(-c2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C17H11N3O2S/c21-16(20-17-18-7-9-23-17)12-10-14(15-6-3-8-22-15)19-13-5-2-1-4-11(12)13/h1-10H,(H,18,20,21) |
| InChIKey | AONFLTXJKGUEML-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |