C20H13N3OS — CID 89422315
4-(1-benzofuran-2-yl)-N-isoquinolin-3-yl-1,3-thiazol-2-amine (PubChem CID 89422315) has the molecular formula C20H13N3OS and a molecular weight of 343.41 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-N-isoquinolin-3-yl-1,3-thiazol-2-amine.
| Compound Name | 4-(1-benzofuran-2-yl)-N-isoquinolin-3-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 89422315 |
| Molecular Formula | C20H13N3OS |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-N-isoquinolin-3-yl-1,3-thiazol-2-amine |
| SMILES | c1ccc2cc(Nc3nc(-c4cc5ccccc5o4)cs3)ncc2c1 |
| InChI | InChI=1S/C20H13N3OS/c1-2-7-15-11-21-19(10-13(15)5-1)23-20-22-16(12-25-20)18-9-14-6-3-4-8-17(14)24-18/h1-12H,(H,21,22,23) |
| InChIKey | FOZFJKQMSXFYAL-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |