C15H14N2O2S — CID 2484138
4-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]morpholine (PubChem CID 2484138) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 4-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]morpholine.
| Compound Name | 4-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]morpholine |
|---|---|
| PubChem CID | 2484138 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]morpholine |
| SMILES | c1ccc2oc(-c3csc(N4CCOCC4)n3)cc2c1 |
| InChI | InChI=1S/C15H14N2O2S/c1-2-4-13-11(3-1)9-14(19-13)12-10-20-15(16-12)17-5-7-18-8-6-17/h1-4,9-10H,5-8H2 |
| InChIKey | WWQAAZCCXXBDEE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |