(7-fluoro-1H-indol-4-yl)boronic acid

C8H7BFNO2 — CID 119085742

IUPAC(7-fluoro-1H-indol-4-yl)boronic acid
SMILESOB(O)c1ccc(F)c2[nH]ccc12
InChIInChI=1S/C8H7BFNO2/c10-7-2-1-6(9(12)13)5-3-4-11-8(5)7/h1-4,11-13H
InChIKeyRASBRQOBJWHUEP-UHFFFAOYSA-N
MW178.96 g/mol
LogP-0.01
Rot. Bonds1

About (7-fluoro-1H-indol-4-yl)boronic acid

(7-fluoro-1H-indol-4-yl)boronic acid (PubChem CID 119085742) has the molecular formula C8H7BFNO2 and a molecular weight of 178.96 g/mol. Its IUPAC name is (7-fluoro-1H-indol-4-yl)boronic acid.

Molecular Properties

Compound Name(7-fluoro-1H-indol-4-yl)boronic acid
PubChem CID119085742
Molecular FormulaC8H7BFNO2
Molecular Weight178.96 g/mol
Exact Mass179.06
IUPAC Name(7-fluoro-1H-indol-4-yl)boronic acid
SMILESOB(O)c1ccc(F)c2[nH]ccc12
InChIInChI=1S/C8H7BFNO2/c10-7-2-1-6(9(12)13)5-3-4-11-8(5)7/h1-4,11-13H
InChIKeyRASBRQOBJWHUEP-UHFFFAOYSA-N
XLogP-0.01
TPSA56.25 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.96
LogP ≤ 5-0.01
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (7-fluoro-1H-indol-4-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (7-fluoro-1H-indol-4-yl)boronic acid?
The IUPAC name of (7-fluoro-1H-indol-4-yl)boronic acid (CID 119085742) is (7-fluoro-1H-indol-4-yl)boronic acid.
What is the SMILES notation for (7-fluoro-1H-indol-4-yl)boronic acid?
The canonical SMILES for (7-fluoro-1H-indol-4-yl)boronic acid is OB(O)c1ccc(F)c2[nH]ccc12.
What is the InChIKey of (7-fluoro-1H-indol-4-yl)boronic acid?
The InChIKey is RASBRQOBJWHUEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BFNO2/c10-7-2-1-6(9(12)13)5-3-4-11-8(5)7/h1-4,11-13H.
What are the key properties of (7-fluoro-1H-indol-4-yl)boronic acid?
(7-fluoro-1H-indol-4-yl)boronic acid has a molecular weight of 178.96 g/mol, XLogP of -0.01, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7-fluoro-1H-indol-4-yl)boronic acid is sourced from PubChem (CID 119085742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).