C10H9F4N — CID 142246490
ethane;4,5,6,7-tetrafluoro-1H-indole (PubChem CID 142246490) has the molecular formula C10H9F4N and a molecular weight of 219.18 g/mol. Its IUPAC name is ethane;4,5,6,7-tetrafluoro-1H-indole.
| Compound Name | ethane;4,5,6,7-tetrafluoro-1H-indole |
|---|---|
| PubChem CID | 142246490 |
| Molecular Formula | C10H9F4N |
| Molecular Weight | 219.18 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | ethane;4,5,6,7-tetrafluoro-1H-indole |
| SMILES | CC.Fc1c(F)c(F)c2[nH]ccc2c1F |
| InChI | InChI=1S/C8H3F4N.C2H6/c9-4-3-1-2-13-8(3)7(12)6(11)5(4)10;1-2/h1-2,13H;1-2H3 |
| InChIKey | YAHUTDSPEDDFPF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.18 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|