C11H12N2OS — CID 119087583
N-[2-(aminomethyl)-1-benzothiophen-5-yl]acetamide (PubChem CID 119087583) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is N-[2-(aminomethyl)-1-benzothiophen-5-yl]acetamide.
| Compound Name | N-[2-(aminomethyl)-1-benzothiophen-5-yl]acetamide |
|---|---|
| PubChem CID | 119087583 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | N-[2-(aminomethyl)-1-benzothiophen-5-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2sc(CN)cc2c1 |
| InChI | InChI=1S/C11H12N2OS/c1-7(14)13-9-2-3-11-8(4-9)5-10(6-12)15-11/h2-5H,6,12H2,1H3,(H,13,14) |
| InChIKey | WDVRUWBFKDDXNV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |