C19H17NO3S — CID 155343257
3-[5-[(4-methylbenzoyl)amino]-1-benzothiophen-2-yl]propanoic acid (PubChem CID 155343257) has the molecular formula C19H17NO3S and a molecular weight of 339.42 g/mol. Its IUPAC name is 3-[5-[(4-methylbenzoyl)amino]-1-benzothiophen-2-yl]propanoic acid.
| Compound Name | 3-[5-[(4-methylbenzoyl)amino]-1-benzothiophen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 155343257 |
| Molecular Formula | C19H17NO3S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 3-[5-[(4-methylbenzoyl)amino]-1-benzothiophen-2-yl]propanoic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccc3sc(CCC(=O)O)cc3c2)cc1 |
| InChI | InChI=1S/C19H17NO3S/c1-12-2-4-13(5-3-12)19(23)20-15-6-8-17-14(10-15)11-16(24-17)7-9-18(21)22/h2-6,8,10-11H,7,9H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | XLAPFHWIQTXOQP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |