C22H21NO3S — CID 155343256
(E)-3-[5-[(4-tert-butylbenzoyl)amino]-1-benzothiophen-2-yl]prop-2-enoic acid (PubChem CID 155343256) has the molecular formula C22H21NO3S and a molecular weight of 379.48 g/mol. Its IUPAC name is (E)-3-[5-[(4-tert-butylbenzoyl)amino]-1-benzothiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[(4-tert-butylbenzoyl)amino]-1-benzothiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 155343256 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (E)-3-[5-[(4-tert-butylbenzoyl)amino]-1-benzothiophen-2-yl]prop-2-enoic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc3sc(/C=C/C(=O)O)cc3c2)cc1 |
| InChI | InChI=1S/C22H21NO3S/c1-22(2,3)16-6-4-14(5-7-16)21(26)23-17-8-10-19-15(12-17)13-18(27-19)9-11-20(24)25/h4-13H,1-3H3,(H,23,26)(H,24,25)/b11-9+ |
| InChIKey | SMUONHNMEUFNRS-PKNBQFBNSA-N |
| XLogP | 5.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|