C27H33N3O3S2 — CID 178090955
2-[(4-tert-butylphenyl)sulfanylamino]-N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-1-benzothiophen-5-yl]-4-methylpentanamide (PubChem CID 178090955) has the molecular formula C27H33N3O3S2 and a molecular weight of 511.71 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)sulfanylamino]-N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-1-benzothiophen-5-yl]-4-methylpentanamide.
| Compound Name | 2-[(4-tert-butylphenyl)sulfanylamino]-N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-1-benzothiophen-5-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 178090955 |
| Molecular Formula | C27H33N3O3S2 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | 2-[(4-tert-butylphenyl)sulfanylamino]-N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-1-benzothiophen-5-yl]-4-methylpentanamide |
| SMILES | CC(C)CC(NSc1ccc(C(C)(C)C)cc1)C(=O)Nc1ccc2sc(/C=C/C(=O)NO)cc2c1 |
| InChI | InChI=1S/C27H33N3O3S2/c1-17(2)14-23(30-35-21-9-6-19(7-10-21)27(3,4)5)26(32)28-20-8-12-24-18(15-20)16-22(34-24)11-13-25(31)29-33/h6-13,15-17,23,30,33H,14H2,1-5H3,(H,28,32)(H,29,31)/b13-11+ |
| InChIKey | CPADWQWWOAGLHI-ACCUITESSA-N |
| XLogP | 6.37 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|