C31H30N2O4S — CID 178090930
(E)-3-[5-[[2-[(4-tert-butylbenzoyl)amino]-3-phenylpropanoyl]amino]-1-benzothiophen-2-yl]prop-2-enoic acid (PubChem CID 178090930) has the molecular formula C31H30N2O4S and a molecular weight of 526.66 g/mol. Its IUPAC name is (E)-3-[5-[[2-[(4-tert-butylbenzoyl)amino]-3-phenylpropanoyl]amino]-1-benzothiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[[2-[(4-tert-butylbenzoyl)amino]-3-phenylpropanoyl]amino]-1-benzothiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 178090930 |
| Molecular Formula | C31H30N2O4S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | (E)-3-[5-[[2-[(4-tert-butylbenzoyl)amino]-3-phenylpropanoyl]amino]-1-benzothiophen-2-yl]prop-2-enoic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(Cc2ccccc2)C(=O)Nc2ccc3sc(/C=C/C(=O)O)cc3c2)cc1 |
| InChI | InChI=1S/C31H30N2O4S/c1-31(2,3)23-11-9-21(10-12-23)29(36)33-26(17-20-7-5-4-6-8-20)30(37)32-24-13-15-27-22(18-24)19-25(38-27)14-16-28(34)35/h4-16,18-19,26H,17H2,1-3H3,(H,32,37)(H,33,36)(H,34,35)/b16-14+ |
| InChIKey | GYNLUXDCYGWQPE-JQIJEIRASA-N |
| XLogP | 6.28 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|