C25H23N3O5S2 — CID 73127857
N-hydroxy-5-[[2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]-1-benzothiophene-2-carboxamide (PubChem CID 73127857) has the molecular formula C25H23N3O5S2 and a molecular weight of 509.61 g/mol. Its IUPAC name is N-hydroxy-5-[[2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]-1-benzothiophene-2-carboxamide.
| Compound Name | N-hydroxy-5-[[2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 73127857 |
| Molecular Formula | C25H23N3O5S2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | N-hydroxy-5-[[2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(Cc2ccccc2)C(=O)Nc2ccc3sc(C(=O)NO)cc3c2)cc1 |
| InChI | InChI=1S/C25H23N3O5S2/c1-16-7-10-20(11-8-16)35(32,33)28-21(13-17-5-3-2-4-6-17)24(29)26-19-9-12-22-18(14-19)15-23(34-22)25(30)27-31/h2-12,14-15,21,28,31H,13H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | JKQLUUFUDZOABW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|