C18H14FNO3S — CID 155343353
3-[5-[(4-fluorobenzoyl)amino]-1-benzothiophen-2-yl]propanoic acid (PubChem CID 155343353) has the molecular formula C18H14FNO3S and a molecular weight of 343.38 g/mol. Its IUPAC name is 3-[5-[(4-fluorobenzoyl)amino]-1-benzothiophen-2-yl]propanoic acid.
| Compound Name | 3-[5-[(4-fluorobenzoyl)amino]-1-benzothiophen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 155343353 |
| Molecular Formula | C18H14FNO3S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 3-[5-[(4-fluorobenzoyl)amino]-1-benzothiophen-2-yl]propanoic acid |
| SMILES | O=C(O)CCc1cc2cc(NC(=O)c3ccc(F)cc3)ccc2s1 |
| InChI | InChI=1S/C18H14FNO3S/c19-13-3-1-11(2-4-13)18(23)20-14-5-7-16-12(9-14)10-15(24-16)6-8-17(21)22/h1-5,7,9-10H,6,8H2,(H,20,23)(H,21,22) |
| InChIKey | RHGRNHOXONPTMH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |