C16H10BrF3NO3PS — CID 168955364
[[3-bromo-5-[(4-fluorobenzoyl)amino]-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid (PubChem CID 168955364) has the molecular formula C16H10BrF3NO3PS and a molecular weight of 464.20 g/mol. Its IUPAC name is [[3-bromo-5-[(4-fluorobenzoyl)amino]-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid.
| Compound Name | [[3-bromo-5-[(4-fluorobenzoyl)amino]-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid |
|---|---|
| PubChem CID | 168955364 |
| Molecular Formula | C16H10BrF3NO3PS |
| Molecular Weight | 464.20 g/mol |
| Exact Mass | 462.93 |
| IUPAC Name | [[3-bromo-5-[(4-fluorobenzoyl)amino]-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid |
| SMILES | O=C(Nc1ccc2sc(C(F)(F)P(O)O)c(Br)c2c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H10BrF3NO3PS/c17-13-11-7-10(21-15(22)8-1-3-9(18)4-2-8)5-6-12(11)26-14(13)16(19,20)25(23)24/h1-7,23-24H,(H,21,22) |
| InChIKey | HUXZMCOJDCZIBG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.20 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|