C17H11F2N2O3PS — CID 168955205
[[3-cyano-5-(phenylcarbamoyl)-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid (PubChem CID 168955205) has the molecular formula C17H11F2N2O3PS and a molecular weight of 392.32 g/mol. Its IUPAC name is [[3-cyano-5-(phenylcarbamoyl)-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid.
| Compound Name | [[3-cyano-5-(phenylcarbamoyl)-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid |
|---|---|
| PubChem CID | 168955205 |
| Molecular Formula | C17H11F2N2O3PS |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | [[3-cyano-5-(phenylcarbamoyl)-1-benzothiophen-2-yl]-difluoromethyl]phosphonous acid |
| SMILES | N#Cc1c(C(F)(F)P(O)O)sc2ccc(C(=O)Nc3ccccc3)cc12 |
| InChI | InChI=1S/C17H11F2N2O3PS/c18-17(19,25(23)24)15-13(9-20)12-8-10(6-7-14(12)26-15)16(22)21-11-4-2-1-3-5-11/h1-8,23-24H,(H,21,22) |
| InChIKey | MKQZKTOXHLYZRL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|