C21H14BrF2N2O4PS2 — CID 175683124
[[3-bromo-5-[(6-phenylsulfanyl-3-pyridinyl)carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid (PubChem CID 175683124) has the molecular formula C21H14BrF2N2O4PS2 and a molecular weight of 571.36 g/mol. Its IUPAC name is [[3-bromo-5-[(6-phenylsulfanyl-3-pyridinyl)carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid.
| Compound Name | [[3-bromo-5-[(6-phenylsulfanyl-3-pyridinyl)carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 175683124 |
| Molecular Formula | C21H14BrF2N2O4PS2 |
| Molecular Weight | 571.36 g/mol |
| Exact Mass | 569.93 |
| IUPAC Name | [[3-bromo-5-[(6-phenylsulfanyl-3-pyridinyl)carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid |
| SMILES | O=C(Nc1ccc(Sc2ccccc2)nc1)c1ccc2sc(C(F)(F)P(=O)(O)O)c(Br)c2c1 |
| InChI | InChI=1S/C21H14BrF2N2O4PS2/c22-18-15-10-12(6-8-16(15)33-19(18)21(23,24)31(28,29)30)20(27)26-13-7-9-17(25-11-13)32-14-4-2-1-3-5-14/h1-11H,(H,26,27)(H2,28,29,30) |
| InChIKey | KIRONXFEQNCNNQ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.36 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|