C23H17BrF2NO5PS — CID 175683045
[[3-bromo-5-[methyl-(3-phenoxyphenyl)carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid (PubChem CID 175683045) has the molecular formula C23H17BrF2NO5PS and a molecular weight of 568.33 g/mol. Its IUPAC name is [[3-bromo-5-[methyl-(3-phenoxyphenyl)carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid.
| Compound Name | [[3-bromo-5-[methyl-(3-phenoxyphenyl)carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 175683045 |
| Molecular Formula | C23H17BrF2NO5PS |
| Molecular Weight | 568.33 g/mol |
| Exact Mass | 566.97 |
| IUPAC Name | [[3-bromo-5-[methyl-(3-phenoxyphenyl)carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid |
| SMILES | CN(C(=O)c1ccc2sc(C(F)(F)P(=O)(O)O)c(Br)c2c1)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C23H17BrF2NO5PS/c1-27(15-6-5-9-17(13-15)32-16-7-3-2-4-8-16)22(28)14-10-11-19-18(12-14)20(24)21(34-19)23(25,26)33(29,30)31/h2-13H,1H3,(H2,29,30,31) |
| InChIKey | OVWNTFFJGKTJCP-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.33 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|