C13H14BrF2O4PS — CID 168954805
3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-1-benzothiophen-5-ol (PubChem CID 168954805) has the molecular formula C13H14BrF2O4PS and a molecular weight of 415.19 g/mol. Its IUPAC name is 3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-1-benzothiophen-5-ol.
| Compound Name | 3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-1-benzothiophen-5-ol |
|---|---|
| PubChem CID | 168954805 |
| Molecular Formula | C13H14BrF2O4PS |
| Molecular Weight | 415.19 g/mol |
| Exact Mass | 413.95 |
| IUPAC Name | 3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-1-benzothiophen-5-ol |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1sc2ccc(O)cc2c1Br |
| InChI | InChI=1S/C13H14BrF2O4PS/c1-3-19-21(18,20-4-2)13(15,16)12-11(14)9-7-8(17)5-6-10(9)22-12/h5-7,17H,3-4H2,1-2H3 |
| InChIKey | PMCIIAYEWXXXIC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.19 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|