C23H22BrF2N2O7PS2 — CID 176640223
3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-7-[(2-isocyano-4-methylsulfonylphenyl)methoxy]-1-benzothiophene-5-carboxamide (PubChem CID 176640223) has the molecular formula C23H22BrF2N2O7PS2 and a molecular weight of 651.44 g/mol. Its IUPAC name is 3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-7-[(2-isocyano-4-methylsulfonylphenyl)methoxy]-1-benzothiophene-5-carboxamide.
| Compound Name | 3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-7-[(2-isocyano-4-methylsulfonylphenyl)methoxy]-1-benzothiophene-5-carboxamide |
|---|---|
| PubChem CID | 176640223 |
| Molecular Formula | C23H22BrF2N2O7PS2 |
| Molecular Weight | 651.44 g/mol |
| Exact Mass | 649.98 |
| IUPAC Name | 3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-7-[(2-isocyano-4-methylsulfonylphenyl)methoxy]-1-benzothiophene-5-carboxamide |
| SMILES | [C-]#[N+]c1cc(S(C)(=O)=O)ccc1COc1cc(C(N)=O)cc2c(Br)c(C(F)(F)P(=O)(OCC)OCC)sc12 |
| InChI | InChI=1S/C23H22BrF2N2O7PS2/c1-5-34-36(30,35-6-2)23(25,26)21-19(24)16-9-14(22(27)29)10-18(20(16)37-21)33-12-13-7-8-15(38(4,31)32)11-17(13)28-3/h7-11H,5-6,12H2,1-2,4H3,(H2,27,29) |
| InChIKey | IUMHPRYCKANKJQ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.44 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|