C12H8BrF2N2O5PS — CID 175683222
[[3-bromo-5-carbamoyl-7-(cyanomethoxy)-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid (PubChem CID 175683222) has the molecular formula C12H8BrF2N2O5PS and a molecular weight of 441.15 g/mol. Its IUPAC name is [[3-bromo-5-carbamoyl-7-(cyanomethoxy)-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid.
| Compound Name | [[3-bromo-5-carbamoyl-7-(cyanomethoxy)-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 175683222 |
| Molecular Formula | C12H8BrF2N2O5PS |
| Molecular Weight | 441.15 g/mol |
| Exact Mass | 439.90 |
| IUPAC Name | [[3-bromo-5-carbamoyl-7-(cyanomethoxy)-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid |
| SMILES | N#CCOc1cc(C(N)=O)cc2c(Br)c(C(F)(F)P(=O)(O)O)sc12 |
| InChI | InChI=1S/C12H8BrF2N2O5PS/c13-8-6-3-5(11(17)18)4-7(22-2-1-16)9(6)24-10(8)12(14,15)23(19,20)21/h3-4H,2H2,(H2,17,18)(H2,19,20,21) |
| InChIKey | VCHUVBOJPRHHGT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 133.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.15 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|