C17H23BrF2NO3PS — CID 168955215
3-bromo-2-[diethoxyphosphanyl(difluoro)methyl]-7-methyl-1-benzothiophene-5-carboxamide;ethane (PubChem CID 168955215) has the molecular formula C17H23BrF2NO3PS and a molecular weight of 470.32 g/mol. Its IUPAC name is 3-bromo-2-[diethoxyphosphanyl(difluoro)methyl]-7-methyl-1-benzothiophene-5-carboxamide;ethane.
| Compound Name | 3-bromo-2-[diethoxyphosphanyl(difluoro)methyl]-7-methyl-1-benzothiophene-5-carboxamide;ethane |
|---|---|
| PubChem CID | 168955215 |
| Molecular Formula | C17H23BrF2NO3PS |
| Molecular Weight | 470.32 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | 3-bromo-2-[diethoxyphosphanyl(difluoro)methyl]-7-methyl-1-benzothiophene-5-carboxamide;ethane |
| SMILES | CC.CCOP(OCC)C(F)(F)c1sc2c(C)cc(C(N)=O)cc2c1Br |
| InChI | InChI=1S/C15H17BrF2NO3PS.C2H6/c1-4-21-23(22-5-2)15(17,18)13-11(16)10-7-9(14(19)20)6-8(3)12(10)24-13;1-2/h6-7H,4-5H2,1-3H3,(H2,19,20);1-2H3 |
| InChIKey | MYVQCTGXUYKCBD-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.32 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|