C20H20BrF2N2O3PS — CID 168954810
1-[3-bromo-2-[diethoxyphosphanyl(difluoro)methyl]-1-benzothiophen-5-yl]-3-phenylurea (PubChem CID 168954810) has the molecular formula C20H20BrF2N2O3PS and a molecular weight of 517.33 g/mol. Its IUPAC name is 1-[3-bromo-2-[diethoxyphosphanyl(difluoro)methyl]-1-benzothiophen-5-yl]-3-phenylurea.
| Compound Name | 1-[3-bromo-2-[diethoxyphosphanyl(difluoro)methyl]-1-benzothiophen-5-yl]-3-phenylurea |
|---|---|
| PubChem CID | 168954810 |
| Molecular Formula | C20H20BrF2N2O3PS |
| Molecular Weight | 517.33 g/mol |
| Exact Mass | 516.01 |
| IUPAC Name | 1-[3-bromo-2-[diethoxyphosphanyl(difluoro)methyl]-1-benzothiophen-5-yl]-3-phenylurea |
| SMILES | CCOP(OCC)C(F)(F)c1sc2ccc(NC(=O)Nc3ccccc3)cc2c1Br |
| InChI | InChI=1S/C20H20BrF2N2O3PS/c1-3-27-29(28-4-2)20(22,23)18-17(21)15-12-14(10-11-16(15)30-18)25-19(26)24-13-8-6-5-7-9-13/h5-12H,3-4H2,1-2H3,(H2,24,25,26) |
| InChIKey | FLQOEHKZQMRISD-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.33 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|