C20H20N2O4S — CID 53106873
methyl 5-[(4-ethylphenyl)carbamoylamino]-3-methoxy-1-benzothiophene-2-carboxylate (PubChem CID 53106873) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is methyl 5-[(4-ethylphenyl)carbamoylamino]-3-methoxy-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 5-[(4-ethylphenyl)carbamoylamino]-3-methoxy-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 53106873 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | methyl 5-[(4-ethylphenyl)carbamoylamino]-3-methoxy-1-benzothiophene-2-carboxylate |
| SMILES | CCc1ccc(NC(=O)Nc2ccc3sc(C(=O)OC)c(OC)c3c2)cc1 |
| InChI | InChI=1S/C20H20N2O4S/c1-4-12-5-7-13(8-6-12)21-20(24)22-14-9-10-16-15(11-14)17(25-2)18(27-16)19(23)26-3/h5-11H,4H2,1-3H3,(H2,21,22,24) |
| InChIKey | FZXPGEQSSJLTGH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |