C20H18FNO4S — CID 46380774
methyl 3-ethoxy-5-[[2-(4-fluorophenyl)acetyl]amino]-1-benzothiophene-2-carboxylate (PubChem CID 46380774) has the molecular formula C20H18FNO4S and a molecular weight of 387.43 g/mol. Its IUPAC name is methyl 3-ethoxy-5-[[2-(4-fluorophenyl)acetyl]amino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-ethoxy-5-[[2-(4-fluorophenyl)acetyl]amino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 46380774 |
| Molecular Formula | C20H18FNO4S |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | methyl 3-ethoxy-5-[[2-(4-fluorophenyl)acetyl]amino]-1-benzothiophene-2-carboxylate |
| SMILES | CCOc1c(C(=O)OC)sc2ccc(NC(=O)Cc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C20H18FNO4S/c1-3-26-18-15-11-14(8-9-16(15)27-19(18)20(24)25-2)22-17(23)10-12-4-6-13(21)7-5-12/h4-9,11H,3,10H2,1-2H3,(H,22,23) |
| InChIKey | UFPLAFOETMQNDU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |