C18H15FN2O4S — CID 53106895
methyl 5-[(4-fluorophenyl)carbamoylamino]-3-methoxy-1-benzothiophene-2-carboxylate (PubChem CID 53106895) has the molecular formula C18H15FN2O4S and a molecular weight of 374.39 g/mol. Its IUPAC name is methyl 5-[(4-fluorophenyl)carbamoylamino]-3-methoxy-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 5-[(4-fluorophenyl)carbamoylamino]-3-methoxy-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 53106895 |
| Molecular Formula | C18H15FN2O4S |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | methyl 5-[(4-fluorophenyl)carbamoylamino]-3-methoxy-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2ccc(NC(=O)Nc3ccc(F)cc3)cc2c1OC |
| InChI | InChI=1S/C18H15FN2O4S/c1-24-15-13-9-12(7-8-14(13)26-16(15)17(22)25-2)21-18(23)20-11-5-3-10(19)4-6-11/h3-9H,1-2H3,(H2,20,21,23) |
| InChIKey | HDPUJJULFZHSIH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |