C20H19BrF2NO4PS — CID 168954956
N-[3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-1-benzothiophen-6-yl]benzamide (PubChem CID 168954956) has the molecular formula C20H19BrF2NO4PS and a molecular weight of 518.32 g/mol. Its IUPAC name is N-[3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-1-benzothiophen-6-yl]benzamide.
| Compound Name | N-[3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-1-benzothiophen-6-yl]benzamide |
|---|---|
| PubChem CID | 168954956 |
| Molecular Formula | C20H19BrF2NO4PS |
| Molecular Weight | 518.32 g/mol |
| Exact Mass | 516.99 |
| IUPAC Name | N-[3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-1-benzothiophen-6-yl]benzamide |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1sc2cc(NC(=O)c3ccccc3)ccc2c1Br |
| InChI | InChI=1S/C20H19BrF2NO4PS/c1-3-27-29(26,28-4-2)20(22,23)18-17(21)15-11-10-14(12-16(15)30-18)24-19(25)13-8-6-5-7-9-13/h5-12H,3-4H2,1-2H3,(H,24,25) |
| InChIKey | OPKJEOUTKZOBPB-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.32 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|