C23H30BrF2O8PS — CID 168955286
tert-butyl 3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-7-(4-methoxy-4-oxobutoxy)-1-benzothiophene-5-carboxylate (PubChem CID 168955286) has the molecular formula C23H30BrF2O8PS and a molecular weight of 615.43 g/mol. Its IUPAC name is tert-butyl 3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-7-(4-methoxy-4-oxobutoxy)-1-benzothiophene-5-carboxylate.
| Compound Name | tert-butyl 3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-7-(4-methoxy-4-oxobutoxy)-1-benzothiophene-5-carboxylate |
|---|---|
| PubChem CID | 168955286 |
| Molecular Formula | C23H30BrF2O8PS |
| Molecular Weight | 615.43 g/mol |
| Exact Mass | 614.06 |
| IUPAC Name | tert-butyl 3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-7-(4-methoxy-4-oxobutoxy)-1-benzothiophene-5-carboxylate |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1sc2c(OCCCC(=O)OC)cc(C(=O)OC(C)(C)C)cc2c1Br |
| InChI | InChI=1S/C23H30BrF2O8PS/c1-7-32-35(29,33-8-2)23(25,26)20-18(24)15-12-14(21(28)34-22(3,4)5)13-16(19(15)36-20)31-11-9-10-17(27)30-6/h12-13H,7-11H2,1-6H3 |
| InChIKey | OTOKOJNZWBGMJI-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.43 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|