C31H40BF2O8PS — CID 168955098
tert-butyl 2-[diethoxyphosphoryl(difluoro)methyl]-7-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophene-5-carboxylate (PubChem CID 168955098) has the molecular formula C31H40BF2O8PS and a molecular weight of 652.50 g/mol. Its IUPAC name is tert-butyl 2-[diethoxyphosphoryl(difluoro)methyl]-7-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophene-5-carboxylate.
| Compound Name | tert-butyl 2-[diethoxyphosphoryl(difluoro)methyl]-7-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophene-5-carboxylate |
|---|---|
| PubChem CID | 168955098 |
| Molecular Formula | C31H40BF2O8PS |
| Molecular Weight | 652.50 g/mol |
| Exact Mass | 652.22 |
| IUPAC Name | tert-butyl 2-[diethoxyphosphoryl(difluoro)methyl]-7-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophene-5-carboxylate |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1sc2c(OCc3ccccc3)cc(C(=O)OC(C)(C)C)cc2c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C31H40BF2O8PS/c1-10-38-43(36,39-11-2)31(33,34)26-24(32-41-29(6,7)30(8,9)42-32)22-17-21(27(35)40-28(3,4)5)18-23(25(22)44-26)37-19-20-15-13-12-14-16-20/h12-18H,10-11,19H2,1-9H3 |
| InChIKey | RPFBCKPRICGZFH-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.50 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|