C22H28BrF5NO6PS — CID 168955324
tert-butyl N-[3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-7-(4,4,4-trifluorobutoxy)-1-benzothiophen-5-yl]carbamate (PubChem CID 168955324) has the molecular formula C22H28BrF5NO6PS and a molecular weight of 640.40 g/mol. Its IUPAC name is tert-butyl N-[3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-7-(4,4,4-trifluorobutoxy)-1-benzothiophen-5-yl]carbamate.
| Compound Name | tert-butyl N-[3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-7-(4,4,4-trifluorobutoxy)-1-benzothiophen-5-yl]carbamate |
|---|---|
| PubChem CID | 168955324 |
| Molecular Formula | C22H28BrF5NO6PS |
| Molecular Weight | 640.40 g/mol |
| Exact Mass | 639.05 |
| IUPAC Name | tert-butyl N-[3-bromo-2-[diethoxyphosphoryl(difluoro)methyl]-7-(4,4,4-trifluorobutoxy)-1-benzothiophen-5-yl]carbamate |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1sc2c(OCCCC(F)(F)F)cc(NC(=O)OC(C)(C)C)cc2c1Br |
| InChI | InChI=1S/C22H28BrF5NO6PS/c1-6-33-36(31,34-7-2)22(27,28)18-16(23)14-11-13(29-19(30)35-20(3,4)5)12-15(17(14)37-18)32-10-8-9-21(24,25)26/h11-12H,6-10H2,1-5H3,(H,29,30) |
| InChIKey | CBVWHNZXOFEREV-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.40 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|